C11H21N — CID 178147290
(3S,4R)-4-[(Z)-but-2-en-2-yl]-1,3-dimethylpiperidine (PubChem CID 178147290) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (3S,4R)-4-[(Z)-but-2-en-2-yl]-1,3-dimethylpiperidine.
| Compound Name | (3S,4R)-4-[(Z)-but-2-en-2-yl]-1,3-dimethylpiperidine |
|---|---|
| PubChem CID | 178147290 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (3S,4R)-4-[(Z)-but-2-en-2-yl]-1,3-dimethylpiperidine |
| SMILES | C/C=C(/C)[C@@H]1CCN(C)C[C@H]1C |
| InChI | InChI=1S/C11H21N/c1-5-9(2)11-6-7-12(4)8-10(11)3/h5,10-11H,6-8H2,1-4H3/b9-5-/t10-,11+/m1/s1 |
| InChIKey | YSFWMBXMRILRDP-NVIAFKCQSA-N |
| XLogP | 2.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|