C16H29NO2 — CID 115538019
ethyl (3R)-1-(3,5-dimethylcyclohexyl)piperidine-3-carboxylate (PubChem CID 115538019) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is ethyl (3R)-1-(3,5-dimethylcyclohexyl)piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-(3,5-dimethylcyclohexyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 115538019 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | ethyl (3R)-1-(3,5-dimethylcyclohexyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C2CC(C)CC(C)C2)C1 |
| InChI | InChI=1S/C16H29NO2/c1-4-19-16(18)14-6-5-7-17(11-14)15-9-12(2)8-13(3)10-15/h12-15H,4-11H2,1-3H3/t12?,13?,14-,15?/m1/s1 |
| InChIKey | XWVWKKTWFZQWDP-MIGSVPMKSA-N |
| XLogP | 3.09 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |