C8H14N2S — CID 18941091
2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carbothioamide (PubChem CID 18941091) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is 2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carbothioamide.
| Compound Name | 2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carbothioamide |
|---|---|
| PubChem CID | 18941091 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | 2,3,5,6,7,8-hexahydro-1H-pyrrolizine-2-carbothioamide |
| SMILES | NC(=S)C1CC2CCCN2C1 |
| InChI | InChI=1S/C8H14N2S/c9-8(11)6-4-7-2-1-3-10(7)5-6/h6-7H,1-5H2,(H2,9,11) |
| InChIKey | LKTVCCHKBOAYJF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|