C11H21N — CID 59036114
2-propan-2-yl-1,2,3,5,6,7,8,8a-octahydroindolizine (PubChem CID 59036114) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is 2-propan-2-yl-1,2,3,5,6,7,8,8a-octahydroindolizine.
| Compound Name | 2-propan-2-yl-1,2,3,5,6,7,8,8a-octahydroindolizine |
|---|---|
| PubChem CID | 59036114 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 2-propan-2-yl-1,2,3,5,6,7,8,8a-octahydroindolizine |
| SMILES | CC(C)C1CC2CCCCN2C1 |
| InChI | InChI=1S/C11H21N/c1-9(2)10-7-11-5-3-4-6-12(11)8-10/h9-11H,3-8H2,1-2H3 |
| InChIKey | JMVPAEPUTFPKRC-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |