C8H15FN2 — CID 176776273
fluoro(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl)methanamine (PubChem CID 176776273) has the molecular formula C8H15FN2 and a molecular weight of 158.22 g/mol. Its IUPAC name is fluoro(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl)methanamine.
| Compound Name | fluoro(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl)methanamine |
|---|---|
| PubChem CID | 176776273 |
| Molecular Formula | C8H15FN2 |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | fluoro(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-2-yl)methanamine |
| SMILES | NC(F)C1CC2CCCN2C1 |
| InChI | InChI=1S/C8H15FN2/c9-8(10)6-4-7-2-1-3-11(7)5-6/h6-8H,1-5,10H2 |
| InChIKey | LKXJQFYYTKYZIL-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|