C11H21NO4S — CID 107394230
4-(3-methoxy-3-methylpiperidin-1-yl)-1,1-dioxothiolan-3-ol (PubChem CID 107394230) has the molecular formula C11H21NO4S and a molecular weight of 263.36 g/mol. Its IUPAC name is 4-(3-methoxy-3-methylpiperidin-1-yl)-1,1-dioxothiolan-3-ol.
| Compound Name | 4-(3-methoxy-3-methylpiperidin-1-yl)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 107394230 |
| Molecular Formula | C11H21NO4S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 4-(3-methoxy-3-methylpiperidin-1-yl)-1,1-dioxothiolan-3-ol |
| SMILES | COC1(C)CCCN(C2CS(=O)(=O)CC2O)C1 |
| InChI | InChI=1S/C11H21NO4S/c1-11(16-2)4-3-5-12(8-11)9-6-17(14,15)7-10(9)13/h9-10,13H,3-8H2,1-2H3 |
| InChIKey | YMBNZROAWKKDOY-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |