C14H20N2O5S2 — CID 97016337
(3S,4S)-4-[4-(benzenesulfonyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol (PubChem CID 97016337) has the molecular formula C14H20N2O5S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is (3S,4S)-4-[4-(benzenesulfonyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol.
| Compound Name | (3S,4S)-4-[4-(benzenesulfonyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 97016337 |
| Molecular Formula | C14H20N2O5S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (3S,4S)-4-[4-(benzenesulfonyl)piperazin-1-yl]-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)C[C@@H](O)[C@H](N2CCN(S(=O)(=O)c3ccccc3)CC2)C1 |
| InChI | InChI=1S/C14H20N2O5S2/c17-14-11-22(18,19)10-13(14)15-6-8-16(9-7-15)23(20,21)12-4-2-1-3-5-12/h1-5,13-14,17H,6-11H2/t13-,14-/m1/s1 |
| InChIKey | XFEBTWNCJQIYCR-ZIAGYGMSSA-N |
| XLogP | -0.85 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |