C15H21ClN2O6S2 — CID 75443816
4-[4-(3-chloro-4-methoxyphenyl)sulfonylpiperazin-1-yl]-1,1-dioxothiolan-3-ol (PubChem CID 75443816) has the molecular formula C15H21ClN2O6S2 and a molecular weight of 424.93 g/mol. Its IUPAC name is 4-[4-(3-chloro-4-methoxyphenyl)sulfonylpiperazin-1-yl]-1,1-dioxothiolan-3-ol.
| Compound Name | 4-[4-(3-chloro-4-methoxyphenyl)sulfonylpiperazin-1-yl]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 75443816 |
| Molecular Formula | C15H21ClN2O6S2 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 4-[4-(3-chloro-4-methoxyphenyl)sulfonylpiperazin-1-yl]-1,1-dioxothiolan-3-ol |
| SMILES | COc1ccc(S(=O)(=O)N2CCN(C3CS(=O)(=O)CC3O)CC2)cc1Cl |
| InChI | InChI=1S/C15H21ClN2O6S2/c1-24-15-3-2-11(8-12(15)16)26(22,23)18-6-4-17(5-7-18)13-9-25(20,21)10-14(13)19/h2-3,8,13-14,19H,4-7,9-10H2,1H3 |
| InChIKey | YGPXOMPTEVKQLX-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 104.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |