C13H20BClN2O4S — CID 123158328
N-[1-(3-chloro-4-methoxyphenyl)sulfonylpiperidin-4-yl]-methylboronamidic acid (PubChem CID 123158328) has the molecular formula C13H20BClN2O4S and a molecular weight of 346.65 g/mol. Its IUPAC name is N-[1-(3-chloro-4-methoxyphenyl)sulfonylpiperidin-4-yl]-methylboronamidic acid.
| Compound Name | N-[1-(3-chloro-4-methoxyphenyl)sulfonylpiperidin-4-yl]-methylboronamidic acid |
|---|---|
| PubChem CID | 123158328 |
| Molecular Formula | C13H20BClN2O4S |
| Molecular Weight | 346.65 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | N-[1-(3-chloro-4-methoxyphenyl)sulfonylpiperidin-4-yl]-methylboronamidic acid |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(NB(C)O)CC2)cc1Cl |
| InChI | InChI=1S/C13H20BClN2O4S/c1-14(18)16-10-5-7-17(8-6-10)22(19,20)11-3-4-13(21-2)12(15)9-11/h3-4,9-10,16,18H,5-8H2,1-2H3 |
| InChIKey | ZIGYCCHUEFQDGO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.65 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|