C19H26ClN3O5S — CID 1093373
1-[1-(3-chloro-4-methoxyphenyl)sulfonylpiperidine-4-carbonyl]piperidine-4-carboxamide (PubChem CID 1093373) has the molecular formula C19H26ClN3O5S and a molecular weight of 443.95 g/mol. Its IUPAC name is 1-[1-(3-chloro-4-methoxyphenyl)sulfonylpiperidine-4-carbonyl]piperidine-4-carboxamide.
| Compound Name | 1-[1-(3-chloro-4-methoxyphenyl)sulfonylpiperidine-4-carbonyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 1093373 |
| Molecular Formula | C19H26ClN3O5S |
| Molecular Weight | 443.95 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | 1-[1-(3-chloro-4-methoxyphenyl)sulfonylpiperidine-4-carbonyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCC(C(=O)N3CCC(C(N)=O)CC3)CC2)cc1Cl |
| InChI | InChI=1S/C19H26ClN3O5S/c1-28-17-3-2-15(12-16(17)20)29(26,27)23-10-6-14(7-11-23)19(25)22-8-4-13(5-9-22)18(21)24/h2-3,12-14H,4-11H2,1H3,(H2,21,24) |
| InChIKey | NEABEIGIIOCBQJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.95 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |