C13H16Cl2N2O4S — CID 1085510
1-(2,5-dichloro-4-methoxyphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 1085510) has the molecular formula C13H16Cl2N2O4S and a molecular weight of 367.25 g/mol. Its IUPAC name is 1-(2,5-dichloro-4-methoxyphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-(2,5-dichloro-4-methoxyphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 1085510 |
| Molecular Formula | C13H16Cl2N2O4S |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 1-(2,5-dichloro-4-methoxyphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | COc1cc(Cl)c(S(=O)(=O)N2CCC(C(N)=O)CC2)cc1Cl |
| InChI | InChI=1S/C13H16Cl2N2O4S/c1-21-11-6-10(15)12(7-9(11)14)22(19,20)17-4-2-8(3-5-17)13(16)18/h6-8H,2-5H2,1H3,(H2,16,18) |
| InChIKey | LFRQWRTWYWFUOS-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |