C16H24N2O4S — CID 700184
1-(4-methoxy-2,3,5-trimethylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 700184) has the molecular formula C16H24N2O4S and a molecular weight of 340.45 g/mol. Its IUPAC name is 1-(4-methoxy-2,3,5-trimethylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-(4-methoxy-2,3,5-trimethylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 700184 |
| Molecular Formula | C16H24N2O4S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 1-(4-methoxy-2,3,5-trimethylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | COc1c(C)cc(S(=O)(=O)N2CCC(C(N)=O)CC2)c(C)c1C |
| InChI | InChI=1S/C16H24N2O4S/c1-10-9-14(11(2)12(3)15(10)22-4)23(20,21)18-7-5-13(6-8-18)16(17)19/h9,13H,5-8H2,1-4H3,(H2,17,19) |
| InChIKey | YYRVTXFQEGQSNH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |