C15H22N2O4S — CID 110758335
1-(2-methoxy-3,5-dimethylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 110758335) has the molecular formula C15H22N2O4S and a molecular weight of 326.42 g/mol. Its IUPAC name is 1-(2-methoxy-3,5-dimethylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | 1-(2-methoxy-3,5-dimethylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 110758335 |
| Molecular Formula | C15H22N2O4S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 1-(2-methoxy-3,5-dimethylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | COc1c(C)cc(C)cc1S(=O)(=O)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C15H22N2O4S/c1-10-8-11(2)14(21-3)13(9-10)22(19,20)17-6-4-12(5-7-17)15(16)18/h8-9,12H,4-7H2,1-3H3,(H2,16,18) |
| InChIKey | QKAIOZIPXRPYKJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |