C15H23NO3S — CID 110758344
1-(2-methoxy-3,5-dimethylphenyl)sulfonylazepane (PubChem CID 110758344) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is 1-(2-methoxy-3,5-dimethylphenyl)sulfonylazepane.
| Compound Name | 1-(2-methoxy-3,5-dimethylphenyl)sulfonylazepane |
|---|---|
| PubChem CID | 110758344 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | 1-(2-methoxy-3,5-dimethylphenyl)sulfonylazepane |
| SMILES | COc1c(C)cc(C)cc1S(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C15H23NO3S/c1-12-10-13(2)15(19-3)14(11-12)20(17,18)16-8-6-4-5-7-9-16/h10-11H,4-9H2,1-3H3 |
| InChIKey | NLIHGRCSQBDCFD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |