C26H36N2O3 — CID 54404990
1-(4-methoxyphenyl)-3-[4-(4-methoxyphenyl)piperazin-1-yl]-2,2,4,4-tetramethylcyclobutan-1-ol (PubChem CID 54404990) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[4-(4-methoxyphenyl)piperazin-1-yl]-2,2,4,4-tetramethylcyclobutan-1-ol.
| Compound Name | 1-(4-methoxyphenyl)-3-[4-(4-methoxyphenyl)piperazin-1-yl]-2,2,4,4-tetramethylcyclobutan-1-ol |
|---|---|
| PubChem CID | 54404990 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[4-(4-methoxyphenyl)piperazin-1-yl]-2,2,4,4-tetramethylcyclobutan-1-ol |
| SMILES | COc1ccc(N2CCN(C3C(C)(C)C(O)(c4ccc(OC)cc4)C3(C)C)CC2)cc1 |
| InChI | InChI=1S/C26H36N2O3/c1-24(2)23(25(3,4)26(24,29)19-7-11-21(30-5)12-8-19)28-17-15-27(16-18-28)20-9-13-22(31-6)14-10-20/h7-14,23,29H,15-18H2,1-6H3 |
| InChIKey | VQAZCRNMJMZMAX-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|