C21H24N2O2 — CID 102041489
(1S,2S)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,2-dihydronaphthalen-1-ol (PubChem CID 102041489) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is (1S,2S)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,2-dihydronaphthalen-1-ol.
| Compound Name | (1S,2S)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,2-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 102041489 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (1S,2S)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-1,2-dihydronaphthalen-1-ol |
| SMILES | COc1ccc(N2CCN([C@H]3C=Cc4ccccc4[C@@H]3O)CC2)cc1 |
| InChI | InChI=1S/C21H24N2O2/c1-25-18-9-7-17(8-10-18)22-12-14-23(15-13-22)20-11-6-16-4-2-3-5-19(16)21(20)24/h2-11,20-21,24H,12-15H2,1H3/t20-,21-/m0/s1 |
| InChIKey | DAZZVOXSISNMPS-SFTDATJTSA-N |
| XLogP | 2.95 |
| TPSA | 35.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|