C20H21ClN2O — CID 102369231
(1R,2R)-2-[4-(3-chlorophenyl)piperazin-1-yl]-1,2-dihydronaphthalen-1-ol (PubChem CID 102369231) has the molecular formula C20H21ClN2O and a molecular weight of 340.85 g/mol. Its IUPAC name is (1R,2R)-2-[4-(3-chlorophenyl)piperazin-1-yl]-1,2-dihydronaphthalen-1-ol.
| Compound Name | (1R,2R)-2-[4-(3-chlorophenyl)piperazin-1-yl]-1,2-dihydronaphthalen-1-ol |
|---|---|
| PubChem CID | 102369231 |
| Molecular Formula | C20H21ClN2O |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (1R,2R)-2-[4-(3-chlorophenyl)piperazin-1-yl]-1,2-dihydronaphthalen-1-ol |
| SMILES | O[C@@H]1c2ccccc2C=C[C@H]1N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H21ClN2O/c21-16-5-3-6-17(14-16)22-10-12-23(13-11-22)19-9-8-15-4-1-2-7-18(15)20(19)24/h1-9,14,19-20,24H,10-13H2/t19-,20-/m1/s1 |
| InChIKey | BBDMXUWDWXTTJT-WOJBJXKFSA-N |
| XLogP | 3.59 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |