C20H20Cl2N2O — CID 51292072
[2-(2-chlorophenyl)cyclopropyl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone (PubChem CID 51292072) has the molecular formula C20H20Cl2N2O and a molecular weight of 375.30 g/mol. Its IUPAC name is [2-(2-chlorophenyl)cyclopropyl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone.
| Compound Name | [2-(2-chlorophenyl)cyclopropyl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 51292072 |
| Molecular Formula | C20H20Cl2N2O |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | [2-(2-chlorophenyl)cyclopropyl]-[4-(3-chlorophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(C1CC1c1ccccc1Cl)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H20Cl2N2O/c21-14-4-3-5-15(12-14)23-8-10-24(11-9-23)20(25)18-13-17(18)16-6-1-2-7-19(16)22/h1-7,12,17-18H,8-11,13H2 |
| InChIKey | VNQWIPYNDDWYOS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |