C14H20BrClO — CID 83139272
1-bromo-2-[2-(chloromethyl)-3,3-dimethylbutyl]-4-methoxybenzene (PubChem CID 83139272) has the molecular formula C14H20BrClO and a molecular weight of 319.67 g/mol. Its IUPAC name is 1-bromo-2-[2-(chloromethyl)-3,3-dimethylbutyl]-4-methoxybenzene.
| Compound Name | 1-bromo-2-[2-(chloromethyl)-3,3-dimethylbutyl]-4-methoxybenzene |
|---|---|
| PubChem CID | 83139272 |
| Molecular Formula | C14H20BrClO |
| Molecular Weight | 319.67 g/mol |
| Exact Mass | 318.04 |
| IUPAC Name | 1-bromo-2-[2-(chloromethyl)-3,3-dimethylbutyl]-4-methoxybenzene |
| SMILES | COc1ccc(Br)c(CC(CCl)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H20BrClO/c1-14(2,3)11(9-16)7-10-8-12(17-4)5-6-13(10)15/h5-6,8,11H,7,9H2,1-4H3 |
| InChIKey | SHRWCGWZUHISFX-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.67 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|