C12H14BrNO — CID 65379304
3-(2-bromo-5-methoxyphenyl)-2,2-dimethylpropanenitrile (PubChem CID 65379304) has the molecular formula C12H14BrNO and a molecular weight of 268.15 g/mol. Its IUPAC name is 3-(2-bromo-5-methoxyphenyl)-2,2-dimethylpropanenitrile.
| Compound Name | 3-(2-bromo-5-methoxyphenyl)-2,2-dimethylpropanenitrile |
|---|---|
| PubChem CID | 65379304 |
| Molecular Formula | C12H14BrNO |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 3-(2-bromo-5-methoxyphenyl)-2,2-dimethylpropanenitrile |
| SMILES | COc1ccc(Br)c(CC(C)(C)C#N)c1 |
| InChI | InChI=1S/C12H14BrNO/c1-12(2,8-14)7-9-6-10(15-3)4-5-11(9)13/h4-6H,7H2,1-3H3 |
| InChIKey | AMTJDZACSAJNFE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |