C14H21BrO2 — CID 66060635
2-[(2-bromo-5-methoxyphenyl)methyl]-2-ethylbutan-1-ol (PubChem CID 66060635) has the molecular formula C14H21BrO2 and a molecular weight of 301.22 g/mol. Its IUPAC name is 2-[(2-bromo-5-methoxyphenyl)methyl]-2-ethylbutan-1-ol.
| Compound Name | 2-[(2-bromo-5-methoxyphenyl)methyl]-2-ethylbutan-1-ol |
|---|---|
| PubChem CID | 66060635 |
| Molecular Formula | C14H21BrO2 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 2-[(2-bromo-5-methoxyphenyl)methyl]-2-ethylbutan-1-ol |
| SMILES | CCC(CC)(CO)Cc1cc(OC)ccc1Br |
| InChI | InChI=1S/C14H21BrO2/c1-4-14(5-2,10-16)9-11-8-12(17-3)6-7-13(11)15/h6-8,16H,4-5,9-10H2,1-3H3 |
| InChIKey | VMXGFFPGYHYVQP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |