C16H22BrNO — CID 102641215
N-[2-[(2-bromo-5-methoxyphenyl)methyl]-2-methylbut-3-enyl]cyclopropanamine (PubChem CID 102641215) has the molecular formula C16H22BrNO and a molecular weight of 324.26 g/mol. Its IUPAC name is N-[2-[(2-bromo-5-methoxyphenyl)methyl]-2-methylbut-3-enyl]cyclopropanamine.
| Compound Name | N-[2-[(2-bromo-5-methoxyphenyl)methyl]-2-methylbut-3-enyl]cyclopropanamine |
|---|---|
| PubChem CID | 102641215 |
| Molecular Formula | C16H22BrNO |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | N-[2-[(2-bromo-5-methoxyphenyl)methyl]-2-methylbut-3-enyl]cyclopropanamine |
| SMILES | C=CC(C)(CNC1CC1)Cc1cc(OC)ccc1Br |
| InChI | InChI=1S/C16H22BrNO/c1-4-16(2,11-18-13-5-6-13)10-12-9-14(19-3)7-8-15(12)17/h4,7-9,13,18H,1,5-6,10-11H2,2-3H3 |
| InChIKey | HKTXROSDBWZKKM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|