C15H13Br2ClO2 — CID 66157869
1-(2-bromo-5-chlorophenyl)-2-(2-bromo-5-methoxyphenyl)ethanol (PubChem CID 66157869) has the molecular formula C15H13Br2ClO2 and a molecular weight of 420.53 g/mol. Its IUPAC name is 1-(2-bromo-5-chlorophenyl)-2-(2-bromo-5-methoxyphenyl)ethanol.
| Compound Name | 1-(2-bromo-5-chlorophenyl)-2-(2-bromo-5-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 66157869 |
| Molecular Formula | C15H13Br2ClO2 |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 417.90 |
| IUPAC Name | 1-(2-bromo-5-chlorophenyl)-2-(2-bromo-5-methoxyphenyl)ethanol |
| SMILES | COc1ccc(Br)c(CC(O)c2cc(Cl)ccc2Br)c1 |
| InChI | InChI=1S/C15H13Br2ClO2/c1-20-11-3-5-13(16)9(6-11)7-15(19)12-8-10(18)2-4-14(12)17/h2-6,8,15,19H,7H2,1H3 |
| InChIKey | VPEJKURPOUIHKU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |