C18H21BrO2 — CID 105084143
1-(2-bromo-5-methoxyphenyl)-2-(2,4,6-trimethylphenyl)ethanol (PubChem CID 105084143) has the molecular formula C18H21BrO2 and a molecular weight of 349.27 g/mol. Its IUPAC name is 1-(2-bromo-5-methoxyphenyl)-2-(2,4,6-trimethylphenyl)ethanol.
| Compound Name | 1-(2-bromo-5-methoxyphenyl)-2-(2,4,6-trimethylphenyl)ethanol |
|---|---|
| PubChem CID | 105084143 |
| Molecular Formula | C18H21BrO2 |
| Molecular Weight | 349.27 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 1-(2-bromo-5-methoxyphenyl)-2-(2,4,6-trimethylphenyl)ethanol |
| SMILES | COc1ccc(Br)c(C(O)Cc2c(C)cc(C)cc2C)c1 |
| InChI | InChI=1S/C18H21BrO2/c1-11-7-12(2)15(13(3)8-11)10-18(20)16-9-14(21-4)5-6-17(16)19/h5-9,18,20H,10H2,1-4H3 |
| InChIKey | JQJJXLGVLNEEIJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.27 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |