C12H19BrN2O2S — CID 103018361
3-[1-bromo-4-(2-methylpyrazol-3-yl)butan-2-yl]thiolane 1,1-dioxide (PubChem CID 103018361) has the molecular formula C12H19BrN2O2S and a molecular weight of 335.27 g/mol. Its IUPAC name is 3-[1-bromo-4-(2-methylpyrazol-3-yl)butan-2-yl]thiolane 1,1-dioxide.
| Compound Name | 3-[1-bromo-4-(2-methylpyrazol-3-yl)butan-2-yl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 103018361 |
| Molecular Formula | C12H19BrN2O2S |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 3-[1-bromo-4-(2-methylpyrazol-3-yl)butan-2-yl]thiolane 1,1-dioxide |
| SMILES | Cn1nccc1CCC(CBr)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H19BrN2O2S/c1-15-12(4-6-14-15)3-2-10(8-13)11-5-7-18(16,17)9-11/h4,6,10-11H,2-3,5,7-9H2,1H3 |
| InChIKey | GZHGLQOXZCTGKD-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|