C14H20BrNO4S — CID 104658136
[3-bromo-4-(2-methoxyethoxy)phenyl]-(1,1-dioxothiolan-3-yl)methanamine (PubChem CID 104658136) has the molecular formula C14H20BrNO4S and a molecular weight of 378.29 g/mol. Its IUPAC name is [3-bromo-4-(2-methoxyethoxy)phenyl]-(1,1-dioxothiolan-3-yl)methanamine.
| Compound Name | [3-bromo-4-(2-methoxyethoxy)phenyl]-(1,1-dioxothiolan-3-yl)methanamine |
|---|---|
| PubChem CID | 104658136 |
| Molecular Formula | C14H20BrNO4S |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | [3-bromo-4-(2-methoxyethoxy)phenyl]-(1,1-dioxothiolan-3-yl)methanamine |
| SMILES | COCCOc1ccc(C(N)C2CCS(=O)(=O)C2)cc1Br |
| InChI | InChI=1S/C14H20BrNO4S/c1-19-5-6-20-13-3-2-10(8-12(13)15)14(16)11-4-7-21(17,18)9-11/h2-3,8,11,14H,4-7,9,16H2,1H3 |
| InChIKey | NNRFLJGSOINZHY-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|