C16H22BrNO2 — CID 104658143
6-bicyclo[3.1.0]hexanyl-[3-bromo-4-(2-methoxyethoxy)phenyl]methanamine (PubChem CID 104658143) has the molecular formula C16H22BrNO2 and a molecular weight of 340.26 g/mol. Its IUPAC name is 6-bicyclo[3.1.0]hexanyl-[3-bromo-4-(2-methoxyethoxy)phenyl]methanamine.
| Compound Name | 6-bicyclo[3.1.0]hexanyl-[3-bromo-4-(2-methoxyethoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 104658143 |
| Molecular Formula | C16H22BrNO2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 6-bicyclo[3.1.0]hexanyl-[3-bromo-4-(2-methoxyethoxy)phenyl]methanamine |
| SMILES | COCCOc1ccc(C(N)C2C3CCCC32)cc1Br |
| InChI | InChI=1S/C16H22BrNO2/c1-19-7-8-20-14-6-5-10(9-13(14)17)16(18)15-11-3-2-4-12(11)15/h5-6,9,11-12,15-16H,2-4,7-8,18H2,1H3 |
| InChIKey | DPZPQEBQMUJYAT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|