C16H24BrNO3 — CID 103556513
1-[3-bromo-4-(2-methoxyethoxy)phenyl]-2-(1-methoxycyclobutyl)ethanamine (PubChem CID 103556513) has the molecular formula C16H24BrNO3 and a molecular weight of 358.28 g/mol. Its IUPAC name is 1-[3-bromo-4-(2-methoxyethoxy)phenyl]-2-(1-methoxycyclobutyl)ethanamine.
| Compound Name | 1-[3-bromo-4-(2-methoxyethoxy)phenyl]-2-(1-methoxycyclobutyl)ethanamine |
|---|---|
| PubChem CID | 103556513 |
| Molecular Formula | C16H24BrNO3 |
| Molecular Weight | 358.28 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 1-[3-bromo-4-(2-methoxyethoxy)phenyl]-2-(1-methoxycyclobutyl)ethanamine |
| SMILES | COCCOc1ccc(C(N)CC2(OC)CCC2)cc1Br |
| InChI | InChI=1S/C16H24BrNO3/c1-19-8-9-21-15-5-4-12(10-13(15)17)14(18)11-16(20-2)6-3-7-16/h4-5,10,14H,3,6-9,11,18H2,1-2H3 |
| InChIKey | BOZWRPRHYNEDJA-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|