C9H9BrCl2O2S2 — CID 80533646
3-[(5-bromo-4-chlorothiophen-2-yl)-chloromethyl]thiolane 1,1-dioxide (PubChem CID 80533646) has the molecular formula C9H9BrCl2O2S2 and a molecular weight of 364.11 g/mol. Its IUPAC name is 3-[(5-bromo-4-chlorothiophen-2-yl)-chloromethyl]thiolane 1,1-dioxide.
| Compound Name | 3-[(5-bromo-4-chlorothiophen-2-yl)-chloromethyl]thiolane 1,1-dioxide |
|---|---|
| PubChem CID | 80533646 |
| Molecular Formula | C9H9BrCl2O2S2 |
| Molecular Weight | 364.11 g/mol |
| Exact Mass | 361.86 |
| IUPAC Name | 3-[(5-bromo-4-chlorothiophen-2-yl)-chloromethyl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(C(Cl)c2cc(Cl)c(Br)s2)C1 |
| InChI | InChI=1S/C9H9BrCl2O2S2/c10-9-6(11)3-7(15-9)8(12)5-1-2-16(13,14)4-5/h3,5,8H,1-2,4H2 |
| InChIKey | YFQJDHKWRJXZIU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.11 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|