C12H12BrClF2O — CID 114826991
4-[(4-bromo-2,5-difluorophenyl)-chloromethyl]-2-methyloxolane (PubChem CID 114826991) has the molecular formula C12H12BrClF2O and a molecular weight of 325.58 g/mol. Its IUPAC name is 4-[(4-bromo-2,5-difluorophenyl)-chloromethyl]-2-methyloxolane.
| Compound Name | 4-[(4-bromo-2,5-difluorophenyl)-chloromethyl]-2-methyloxolane |
|---|---|
| PubChem CID | 114826991 |
| Molecular Formula | C12H12BrClF2O |
| Molecular Weight | 325.58 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | 4-[(4-bromo-2,5-difluorophenyl)-chloromethyl]-2-methyloxolane |
| SMILES | CC1CC(C(Cl)c2cc(F)c(Br)cc2F)CO1 |
| InChI | InChI=1S/C12H12BrClF2O/c1-6-2-7(5-17-6)12(14)8-3-11(16)9(13)4-10(8)15/h3-4,6-7,12H,2,5H2,1H3 |
| InChIKey | FGSCHGXUPXDXRB-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|