C16H20BrNO3 — CID 81352394
1-[[(1S)-1-(4-bromophenyl)ethyl]amino]-3-(furan-2-ylmethoxy)propan-2-ol (PubChem CID 81352394) has the molecular formula C16H20BrNO3 and a molecular weight of 354.24 g/mol. Its IUPAC name is 1-[[(1S)-1-(4-bromophenyl)ethyl]amino]-3-(furan-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-[[(1S)-1-(4-bromophenyl)ethyl]amino]-3-(furan-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 81352394 |
| Molecular Formula | C16H20BrNO3 |
| Molecular Weight | 354.24 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 1-[[(1S)-1-(4-bromophenyl)ethyl]amino]-3-(furan-2-ylmethoxy)propan-2-ol |
| SMILES | C[C@H](NCC(O)COCc1ccco1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H20BrNO3/c1-12(13-4-6-14(17)7-5-13)18-9-15(19)10-20-11-16-3-2-8-21-16/h2-8,12,15,18-19H,9-11H2,1H3/t12-,15?/m0/s1 |
| InChIKey | UHRGSELMVHKNCO-SFVWDYPZSA-N |
| XLogP | 3.27 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.24 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |