C11H15NO3 — CID 60649357
1-(furan-2-ylmethoxy)-3-(prop-2-ynylamino)propan-2-ol (PubChem CID 60649357) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 1-(furan-2-ylmethoxy)-3-(prop-2-ynylamino)propan-2-ol.
| Compound Name | 1-(furan-2-ylmethoxy)-3-(prop-2-ynylamino)propan-2-ol |
|---|---|
| PubChem CID | 60649357 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 1-(furan-2-ylmethoxy)-3-(prop-2-ynylamino)propan-2-ol |
| SMILES | C#CCNCC(O)COCc1ccco1 |
| InChI | InChI=1S/C11H15NO3/c1-2-5-12-7-10(13)8-14-9-11-4-3-6-15-11/h1,3-4,6,10,12-13H,5,7-9H2 |
| InChIKey | KEHRXGVCHHJWCL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|