C15H28N2O3 — CID 60634350
1-[3-(diethylamino)propylamino]-3-(furan-2-ylmethoxy)propan-2-ol (PubChem CID 60634350) has the molecular formula C15H28N2O3 and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-[3-(diethylamino)propylamino]-3-(furan-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-[3-(diethylamino)propylamino]-3-(furan-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 60634350 |
| Molecular Formula | C15H28N2O3 |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | 1-[3-(diethylamino)propylamino]-3-(furan-2-ylmethoxy)propan-2-ol |
| SMILES | CCN(CC)CCCNCC(O)COCc1ccco1 |
| InChI | InChI=1S/C15H28N2O3/c1-3-17(4-2)9-6-8-16-11-14(18)12-19-13-15-7-5-10-20-15/h5,7,10,14,16,18H,3-4,6,8-9,11-13H2,1-2H3 |
| InChIKey | CBBVBQKDBHZDGL-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 57.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|