C16H28N2O4 — CID 4830564
N-tert-butyl-2-[ethyl-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]amino]acetamide (PubChem CID 4830564) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is N-tert-butyl-2-[ethyl-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[ethyl-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]amino]acetamide |
|---|---|
| PubChem CID | 4830564 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N-tert-butyl-2-[ethyl-[3-(furan-2-ylmethoxy)-2-hydroxypropyl]amino]acetamide |
| SMILES | CCN(CC(=O)NC(C)(C)C)CC(O)COCc1ccco1 |
| InChI | InChI=1S/C16H28N2O4/c1-5-18(10-15(20)17-16(2,3)4)9-13(19)11-21-12-14-7-6-8-22-14/h6-8,13,19H,5,9-12H2,1-4H3,(H,17,20) |
| InChIKey | FLPFLGOYWKDQIH-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |