C19H32N2O4 — CID 4830565
N-tert-butyl-2-[ethyl-[2-hydroxy-3-[(2-methoxyphenyl)methoxy]propyl]amino]acetamide (PubChem CID 4830565) has the molecular formula C19H32N2O4 and a molecular weight of 352.48 g/mol. Its IUPAC name is N-tert-butyl-2-[ethyl-[2-hydroxy-3-[(2-methoxyphenyl)methoxy]propyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[ethyl-[2-hydroxy-3-[(2-methoxyphenyl)methoxy]propyl]amino]acetamide |
|---|---|
| PubChem CID | 4830565 |
| Molecular Formula | C19H32N2O4 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | N-tert-butyl-2-[ethyl-[2-hydroxy-3-[(2-methoxyphenyl)methoxy]propyl]amino]acetamide |
| SMILES | CCN(CC(=O)NC(C)(C)C)CC(O)COCc1ccccc1OC |
| InChI | InChI=1S/C19H32N2O4/c1-6-21(12-18(23)20-19(2,3)4)11-16(22)14-25-13-15-9-7-8-10-17(15)24-5/h7-10,16,22H,6,11-14H2,1-5H3,(H,20,23) |
| InChIKey | YTOKDZGMHOHEDN-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |