C18H21FO4 — CID 110017824
1-(2-fluoro-3-methylphenoxy)-3-[(2-methoxyphenyl)methoxy]propan-2-ol (PubChem CID 110017824) has the molecular formula C18H21FO4 and a molecular weight of 320.36 g/mol. Its IUPAC name is 1-(2-fluoro-3-methylphenoxy)-3-[(2-methoxyphenyl)methoxy]propan-2-ol.
| Compound Name | 1-(2-fluoro-3-methylphenoxy)-3-[(2-methoxyphenyl)methoxy]propan-2-ol |
|---|---|
| PubChem CID | 110017824 |
| Molecular Formula | C18H21FO4 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 1-(2-fluoro-3-methylphenoxy)-3-[(2-methoxyphenyl)methoxy]propan-2-ol |
| SMILES | COc1ccccc1COCC(O)COc1cccc(C)c1F |
| InChI | InChI=1S/C18H21FO4/c1-13-6-5-9-17(18(13)19)23-12-15(20)11-22-10-14-7-3-4-8-16(14)21-2/h3-9,15,20H,10-12H2,1-2H3 |
| InChIKey | XMDCVRQQKXDAOM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |