C17H18ClFO4 — CID 109416037
1-[(2-chlorophenyl)methoxy]-3-(2-fluoro-6-methoxyphenoxy)propan-2-ol (PubChem CID 109416037) has the molecular formula C17H18ClFO4 and a molecular weight of 340.78 g/mol. Its IUPAC name is 1-[(2-chlorophenyl)methoxy]-3-(2-fluoro-6-methoxyphenoxy)propan-2-ol.
| Compound Name | 1-[(2-chlorophenyl)methoxy]-3-(2-fluoro-6-methoxyphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 109416037 |
| Molecular Formula | C17H18ClFO4 |
| Molecular Weight | 340.78 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 1-[(2-chlorophenyl)methoxy]-3-(2-fluoro-6-methoxyphenoxy)propan-2-ol |
| SMILES | COc1cccc(F)c1OCC(O)COCc1ccccc1Cl |
| InChI | InChI=1S/C17H18ClFO4/c1-21-16-8-4-7-15(19)17(16)23-11-13(20)10-22-9-12-5-2-3-6-14(12)18/h2-8,13,20H,9-11H2,1H3 |
| InChIKey | AASKMNUBYSAEMB-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.78 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |