C21H27FN2O4 — CID 78831986
2-[ethyl-[3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]amino]-N-(3-methoxyphenyl)acetamide (PubChem CID 78831986) has the molecular formula C21H27FN2O4 and a molecular weight of 390.46 g/mol. Its IUPAC name is 2-[ethyl-[3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]amino]-N-(3-methoxyphenyl)acetamide.
| Compound Name | 2-[ethyl-[3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]amino]-N-(3-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 78831986 |
| Molecular Formula | C21H27FN2O4 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 2-[ethyl-[3-[(2-fluorophenyl)methoxy]-2-hydroxypropyl]amino]-N-(3-methoxyphenyl)acetamide |
| SMILES | CCN(CC(=O)Nc1cccc(OC)c1)CC(O)COCc1ccccc1F |
| InChI | InChI=1S/C21H27FN2O4/c1-3-24(13-21(26)23-17-8-6-9-19(11-17)27-2)12-18(25)15-28-14-16-7-4-5-10-20(16)22/h4-11,18,25H,3,12-15H2,1-2H3,(H,23,26) |
| InChIKey | ZSWVTTUYYSVERZ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |