C11H17NO3 — CID 93381179
(2R)-1-(furan-2-ylmethoxy)-3-(prop-2-enylamino)propan-2-ol (PubChem CID 93381179) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is (2R)-1-(furan-2-ylmethoxy)-3-(prop-2-enylamino)propan-2-ol.
| Compound Name | (2R)-1-(furan-2-ylmethoxy)-3-(prop-2-enylamino)propan-2-ol |
|---|---|
| PubChem CID | 93381179 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | (2R)-1-(furan-2-ylmethoxy)-3-(prop-2-enylamino)propan-2-ol |
| SMILES | C=CCNC[C@@H](O)COCc1ccco1 |
| InChI | InChI=1S/C11H17NO3/c1-2-5-12-7-10(13)8-14-9-11-4-3-6-15-11/h2-4,6,10,12-13H,1,5,7-9H2/t10-/m1/s1 |
| InChIKey | XZUCUMOTWUERQF-SNVBAGLBSA-N |
| XLogP | 0.93 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|