C14H23NO4 — CID 114756661
1-(furan-2-ylmethoxy)-3-[[1-(2-hydroxyethyl)cyclopropyl]methylamino]propan-2-ol (PubChem CID 114756661) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-(furan-2-ylmethoxy)-3-[[1-(2-hydroxyethyl)cyclopropyl]methylamino]propan-2-ol.
| Compound Name | 1-(furan-2-ylmethoxy)-3-[[1-(2-hydroxyethyl)cyclopropyl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 114756661 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 1-(furan-2-ylmethoxy)-3-[[1-(2-hydroxyethyl)cyclopropyl]methylamino]propan-2-ol |
| SMILES | OCCC1(CNCC(O)COCc2ccco2)CC1 |
| InChI | InChI=1S/C14H23NO4/c16-6-5-14(3-4-14)11-15-8-12(17)9-18-10-13-2-1-7-19-13/h1-2,7,12,15-17H,3-6,8-11H2 |
| InChIKey | OPXQVYCIIFHHSA-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |