C22H24ClNO4 — CID 7872390
2-[[[(2R)-3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]-(furan-2-ylmethyl)amino]methyl]phenol (PubChem CID 7872390) has the molecular formula C22H24ClNO4 and a molecular weight of 401.89 g/mol. Its IUPAC name is 2-[[[(2R)-3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]-(furan-2-ylmethyl)amino]methyl]phenol.
| Compound Name | 2-[[[(2R)-3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]-(furan-2-ylmethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 7872390 |
| Molecular Formula | C22H24ClNO4 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 2-[[[(2R)-3-[(4-chlorophenyl)methoxy]-2-hydroxypropyl]-(furan-2-ylmethyl)amino]methyl]phenol |
| SMILES | Oc1ccccc1CN(Cc1ccco1)C[C@@H](O)COCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H24ClNO4/c23-19-9-7-17(8-10-19)15-27-16-20(25)13-24(14-21-5-3-11-28-21)12-18-4-1-2-6-22(18)26/h1-11,20,25-26H,12-16H2/t20-/m1/s1 |
| InChIKey | CTVPWOGGAJWDEK-HXUWFJFHSA-N |
| XLogP | 4.22 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|