C22H24FNO3 — CID 93164886
(2R)-1-[(3-fluorophenyl)methyl-(furan-2-ylmethyl)amino]-3-phenylmethoxypropan-2-ol (PubChem CID 93164886) has the molecular formula C22H24FNO3 and a molecular weight of 369.44 g/mol. Its IUPAC name is (2R)-1-[(3-fluorophenyl)methyl-(furan-2-ylmethyl)amino]-3-phenylmethoxypropan-2-ol.
| Compound Name | (2R)-1-[(3-fluorophenyl)methyl-(furan-2-ylmethyl)amino]-3-phenylmethoxypropan-2-ol |
|---|---|
| PubChem CID | 93164886 |
| Molecular Formula | C22H24FNO3 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (2R)-1-[(3-fluorophenyl)methyl-(furan-2-ylmethyl)amino]-3-phenylmethoxypropan-2-ol |
| SMILES | O[C@@H](COCc1ccccc1)CN(Cc1cccc(F)c1)Cc1ccco1 |
| InChI | InChI=1S/C22H24FNO3/c23-20-9-4-8-19(12-20)13-24(15-22-10-5-11-27-22)14-21(25)17-26-16-18-6-2-1-3-7-18/h1-12,21,25H,13-17H2/t21-/m1/s1 |
| InChIKey | YTTMFWAIPDJWEK-OAQYLSRUSA-N |
| XLogP | 4.00 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |