C21H21ClFNO3 — CID 35767703
(2S)-1-(4-chlorophenoxy)-3-[(3-fluorophenyl)methyl-(furan-2-ylmethyl)amino]propan-2-ol (PubChem CID 35767703) has the molecular formula C21H21ClFNO3 and a molecular weight of 389.85 g/mol. Its IUPAC name is (2S)-1-(4-chlorophenoxy)-3-[(3-fluorophenyl)methyl-(furan-2-ylmethyl)amino]propan-2-ol.
| Compound Name | (2S)-1-(4-chlorophenoxy)-3-[(3-fluorophenyl)methyl-(furan-2-ylmethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 35767703 |
| Molecular Formula | C21H21ClFNO3 |
| Molecular Weight | 389.85 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | (2S)-1-(4-chlorophenoxy)-3-[(3-fluorophenyl)methyl-(furan-2-ylmethyl)amino]propan-2-ol |
| SMILES | O[C@H](COc1ccc(Cl)cc1)CN(Cc1cccc(F)c1)Cc1ccco1 |
| InChI | InChI=1S/C21H21ClFNO3/c22-17-6-8-20(9-7-17)27-15-19(25)13-24(14-21-5-2-10-26-21)12-16-3-1-4-18(23)11-16/h1-11,19,25H,12-15H2/t19-/m0/s1 |
| InChIKey | JFBUPNSEJLOYHQ-IBGZPJMESA-N |
| XLogP | 4.51 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.85 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |