C20H22FNO4 — CID 46007950
1-[(3-fluorophenyl)methyl-(furan-2-ylmethyl)amino]-3-(furan-2-ylmethoxy)propan-2-ol (PubChem CID 46007950) has the molecular formula C20H22FNO4 and a molecular weight of 359.40 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl-(furan-2-ylmethyl)amino]-3-(furan-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-[(3-fluorophenyl)methyl-(furan-2-ylmethyl)amino]-3-(furan-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 46007950 |
| Molecular Formula | C20H22FNO4 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl-(furan-2-ylmethyl)amino]-3-(furan-2-ylmethoxy)propan-2-ol |
| SMILES | OC(COCc1ccco1)CN(Cc1cccc(F)c1)Cc1ccco1 |
| InChI | InChI=1S/C20H22FNO4/c21-17-5-1-4-16(10-17)11-22(13-19-6-2-8-25-19)12-18(23)14-24-15-20-7-3-9-26-20/h1-10,18,23H,11-15H2 |
| InChIKey | QVCHKOXDEMDRBZ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 58.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |