C18H22FNO2 — CID 93164898
(2S)-1-[(3-fluorophenyl)methyl-(furan-2-ylmethyl)amino]hex-5-en-2-ol (PubChem CID 93164898) has the molecular formula C18H22FNO2 and a molecular weight of 303.38 g/mol. Its IUPAC name is (2S)-1-[(3-fluorophenyl)methyl-(furan-2-ylmethyl)amino]hex-5-en-2-ol.
| Compound Name | (2S)-1-[(3-fluorophenyl)methyl-(furan-2-ylmethyl)amino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 93164898 |
| Molecular Formula | C18H22FNO2 |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | (2S)-1-[(3-fluorophenyl)methyl-(furan-2-ylmethyl)amino]hex-5-en-2-ol |
| SMILES | C=CCC[C@H](O)CN(Cc1cccc(F)c1)Cc1ccco1 |
| InChI | InChI=1S/C18H22FNO2/c1-2-3-8-17(21)13-20(14-18-9-5-10-22-18)12-15-6-4-7-16(19)11-15/h2,4-7,9-11,17,21H,1,3,8,12-14H2/t17-/m0/s1 |
| InChIKey | KHDBPAFIVKHNKQ-KRWDZBQOSA-N |
| XLogP | 3.75 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|