C20H25NO4 — CID 24713530
1-[1,3-benzodioxol-5-ylmethyl-[(5-methylfuran-2-yl)methyl]amino]hex-5-en-2-ol (PubChem CID 24713530) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is 1-[1,3-benzodioxol-5-ylmethyl-[(5-methylfuran-2-yl)methyl]amino]hex-5-en-2-ol.
| Compound Name | 1-[1,3-benzodioxol-5-ylmethyl-[(5-methylfuran-2-yl)methyl]amino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 24713530 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 1-[1,3-benzodioxol-5-ylmethyl-[(5-methylfuran-2-yl)methyl]amino]hex-5-en-2-ol |
| SMILES | C=CCCC(O)CN(Cc1ccc2c(c1)OCO2)Cc1ccc(C)o1 |
| InChI | InChI=1S/C20H25NO4/c1-3-4-5-17(22)12-21(13-18-8-6-15(2)25-18)11-16-7-9-19-20(10-16)24-14-23-19/h3,6-10,17,22H,1,4-5,11-14H2,2H3 |
| InChIKey | OWXYYSABOXFWQO-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 55.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|