C23H29NO5 — CID 93164630
(2R)-1-[1,3-benzodioxol-5-ylmethyl-[(2,3-dimethoxyphenyl)methyl]amino]hex-5-en-2-ol (PubChem CID 93164630) has the molecular formula C23H29NO5 and a molecular weight of 399.49 g/mol. Its IUPAC name is (2R)-1-[1,3-benzodioxol-5-ylmethyl-[(2,3-dimethoxyphenyl)methyl]amino]hex-5-en-2-ol.
| Compound Name | (2R)-1-[1,3-benzodioxol-5-ylmethyl-[(2,3-dimethoxyphenyl)methyl]amino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 93164630 |
| Molecular Formula | C23H29NO5 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (2R)-1-[1,3-benzodioxol-5-ylmethyl-[(2,3-dimethoxyphenyl)methyl]amino]hex-5-en-2-ol |
| SMILES | C=CCC[C@@H](O)CN(Cc1ccc2c(c1)OCO2)Cc1cccc(OC)c1OC |
| InChI | InChI=1S/C23H29NO5/c1-4-5-8-19(25)15-24(13-17-10-11-20-22(12-17)29-16-28-20)14-18-7-6-9-21(26-2)23(18)27-3/h4,6-7,9-12,19,25H,1,5,8,13-16H2,2-3H3/t19-/m1/s1 |
| InChIKey | OUQNTQCSQNVZCP-LJQANCHMSA-N |
| XLogP | 3.76 |
| TPSA | 60.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|