C20H26N2O3 — CID 42837041
1-[1,3-benzodioxol-5-ylmethyl-[(1-methylpyrrol-2-yl)methyl]amino]hex-5-en-2-ol (PubChem CID 42837041) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is 1-[1,3-benzodioxol-5-ylmethyl-[(1-methylpyrrol-2-yl)methyl]amino]hex-5-en-2-ol.
| Compound Name | 1-[1,3-benzodioxol-5-ylmethyl-[(1-methylpyrrol-2-yl)methyl]amino]hex-5-en-2-ol |
|---|---|
| PubChem CID | 42837041 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-[1,3-benzodioxol-5-ylmethyl-[(1-methylpyrrol-2-yl)methyl]amino]hex-5-en-2-ol |
| SMILES | C=CCCC(O)CN(Cc1ccc2c(c1)OCO2)Cc1cccn1C |
| InChI | InChI=1S/C20H26N2O3/c1-3-4-7-18(23)14-22(13-17-6-5-10-21(17)2)12-16-8-9-19-20(11-16)25-15-24-19/h3,5-6,8-11,18,23H,1,4,7,12-15H2,2H3 |
| InChIKey | MAAHQIPMYZRMOI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 46.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|