C24H25NO4 — CID 93147170
(2R)-1-[1,3-benzodioxol-5-ylmethyl(benzyl)amino]-3-phenoxypropan-2-ol (PubChem CID 93147170) has the molecular formula C24H25NO4 and a molecular weight of 391.47 g/mol. Its IUPAC name is (2R)-1-[1,3-benzodioxol-5-ylmethyl(benzyl)amino]-3-phenoxypropan-2-ol.
| Compound Name | (2R)-1-[1,3-benzodioxol-5-ylmethyl(benzyl)amino]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 93147170 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | (2R)-1-[1,3-benzodioxol-5-ylmethyl(benzyl)amino]-3-phenoxypropan-2-ol |
| SMILES | O[C@@H](COc1ccccc1)CN(Cc1ccccc1)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C24H25NO4/c26-21(17-27-22-9-5-2-6-10-22)16-25(14-19-7-3-1-4-8-19)15-20-11-12-23-24(13-20)29-18-28-23/h1-13,21,26H,14-18H2/t21-/m1/s1 |
| InChIKey | SDQXCUHUOQFDAY-OAQYLSRUSA-N |
| XLogP | 3.86 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |