C18H22FNO3 — CID 24714141
1-[cyclopropyl-[(3-fluorophenyl)methyl]amino]-3-(furan-2-ylmethoxy)propan-2-ol (PubChem CID 24714141) has the molecular formula C18H22FNO3 and a molecular weight of 319.38 g/mol. Its IUPAC name is 1-[cyclopropyl-[(3-fluorophenyl)methyl]amino]-3-(furan-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-[cyclopropyl-[(3-fluorophenyl)methyl]amino]-3-(furan-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 24714141 |
| Molecular Formula | C18H22FNO3 |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 1-[cyclopropyl-[(3-fluorophenyl)methyl]amino]-3-(furan-2-ylmethoxy)propan-2-ol |
| SMILES | OC(COCc1ccco1)CN(Cc1cccc(F)c1)C1CC1 |
| InChI | InChI=1S/C18H22FNO3/c19-15-4-1-3-14(9-15)10-20(16-6-7-16)11-17(21)12-22-13-18-5-2-8-23-18/h1-5,8-9,16-17,21H,6-7,10-13H2 |
| InChIKey | WLKFAUPFEKDBJM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |